C28H31NO2 — CID 6444966
1-[2-[4-[(Z)-3-(4-methoxyphenyl)-2-phenylprop-1-enyl]phenoxy]ethyl]pyrrolidine (PubChem CID 6444966) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-3-(4-methoxyphenyl)-2-phenylprop-1-enyl]phenoxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-[4-[(Z)-3-(4-methoxyphenyl)-2-phenylprop-1-enyl]phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 6444966 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[2-[4-[(Z)-3-(4-methoxyphenyl)-2-phenylprop-1-enyl]phenoxy]ethyl]pyrrolidine |
| SMILES | COc1ccc(C/C(=C/c2ccc(OCCN3CCCC3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H31NO2/c1-30-27-13-9-23(10-14-27)21-26(25-7-3-2-4-8-25)22-24-11-15-28(16-12-24)31-20-19-29-17-5-6-18-29/h2-4,7-16,22H,5-6,17-21H2,1H3/b26-22- |
| InChIKey | JXJKUFLOEBQKFH-ROMGYVFFSA-N |
| XLogP | 5.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|