C18H21N5OS — CID 644519
4-[[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]morpholine (PubChem CID 644519) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 4-[[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]morpholine.
| Compound Name | 4-[[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]morpholine |
|---|---|
| PubChem CID | 644519 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-[[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]morpholine |
| SMILES | c1ccc(CCn2nnnc2C(c2cccs2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H21N5OS/c1-2-5-15(6-3-1)8-9-23-18(19-20-21-23)17(16-7-4-14-25-16)22-10-12-24-13-11-22/h1-7,14,17H,8-13H2 |
| InChIKey | LEQLUCRSNUPLDD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |