C19H22FN5S — CID 654539
1-[[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-thiophen-2-ylmethyl]azepane (PubChem CID 654539) has the molecular formula C19H22FN5S and a molecular weight of 371.49 g/mol. Its IUPAC name is 1-[[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-thiophen-2-ylmethyl]azepane.
| Compound Name | 1-[[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-thiophen-2-ylmethyl]azepane |
|---|---|
| PubChem CID | 654539 |
| Molecular Formula | C19H22FN5S |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-thiophen-2-ylmethyl]azepane |
| SMILES | Fc1ccc(Cn2nnnc2C(c2cccs2)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H22FN5S/c20-16-9-7-15(8-10-16)14-25-19(21-22-23-25)18(17-6-5-13-26-17)24-11-3-1-2-4-12-24/h5-10,13,18H,1-4,11-12,14H2 |
| InChIKey | QLYRCNUDUMNWHD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |