C23H26N6S — CID 644605
N-benzyl-1-(1-tert-butyltetrazol-5-yl)-N-(pyridin-3-ylmethyl)-1-thiophen-2-ylmethanamine (PubChem CID 644605) has the molecular formula C23H26N6S and a molecular weight of 418.57 g/mol. Its IUPAC name is N-benzyl-1-(1-tert-butyltetrazol-5-yl)-N-(pyridin-3-ylmethyl)-1-thiophen-2-ylmethanamine.
| Compound Name | N-benzyl-1-(1-tert-butyltetrazol-5-yl)-N-(pyridin-3-ylmethyl)-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 644605 |
| Molecular Formula | C23H26N6S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-benzyl-1-(1-tert-butyltetrazol-5-yl)-N-(pyridin-3-ylmethyl)-1-thiophen-2-ylmethanamine |
| SMILES | CC(C)(C)n1nnnc1C(c1cccs1)N(Cc1ccccc1)Cc1cccnc1 |
| InChI | InChI=1S/C23H26N6S/c1-23(2,3)29-22(25-26-27-29)21(20-12-8-14-30-20)28(16-18-9-5-4-6-10-18)17-19-11-7-13-24-15-19/h4-15,21H,16-17H2,1-3H3 |
| InChIKey | FYBUJFRVPXOOHJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |