C24H28N2O5 — CID 6446318
(E)-but-2-enedioic acid;N-[(5-methoxy-2-methyl-1-phenylindol-3-yl)methyl]propan-2-amine (PubChem CID 6446318) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[(5-methoxy-2-methyl-1-phenylindol-3-yl)methyl]propan-2-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[(5-methoxy-2-methyl-1-phenylindol-3-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 6446318 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[(5-methoxy-2-methyl-1-phenylindol-3-yl)methyl]propan-2-amine |
| SMILES | COc1ccc2c(c1)c(CNC(C)C)c(C)n2-c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H24N2O.C4H4O4/c1-14(2)21-13-19-15(3)22(16-8-6-5-7-9-16)20-11-10-17(23-4)12-18(19)20;5-3(6)1-2-4(7)8/h5-12,14,21H,13H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | RRWYYAPEFMRTCH-WLHGVMLRSA-N |
| XLogP | 4.16 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|