C16H19NO2 — CID 6447983
(2E,4E)-N-(2-methylpropyl)-6-oxo-6-phenylhexa-2,4-dienamide (PubChem CID 6447983) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-6-oxo-6-phenylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-6-oxo-6-phenylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 6447983 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-6-oxo-6-phenylhexa-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO2/c1-13(2)12-17-16(19)11-7-6-10-15(18)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3,(H,17,19)/b10-6+,11-7+ |
| InChIKey | GMAIUKVGNZXDPW-JMQWPVDRSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|