C11H11N3O — CID 645025
(3,5-dimethylpyrazol-1-yl)-pyridin-4-ylmethanone (PubChem CID 645025) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is (3,5-dimethylpyrazol-1-yl)-pyridin-4-ylmethanone.
| Compound Name | (3,5-dimethylpyrazol-1-yl)-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 645025 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (3,5-dimethylpyrazol-1-yl)-pyridin-4-ylmethanone |
| SMILES | Cc1cc(C)n(C(=O)c2ccncc2)n1 |
| InChI | InChI=1S/C11H11N3O/c1-8-7-9(2)14(13-8)11(15)10-3-5-12-6-4-10/h3-7H,1-2H3 |
| InChIKey | VXESXFNPRURVHH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |