About 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one
1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one (PubChem CID 64506189) has the molecular formula C12H12F2O
and a molecular weight of 210.22 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one |
| PubChem CID | 64506189 |
| Molecular Formula | C12H12F2O |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one |
| SMILES | O=C(CCc1c(F)cccc1F)C1CC1 |
| InChI | InChI=1S/C12H12F2O/c13-10-2-1-3-11(14)9(10)6-7-12(15)8-4-5-8/h1-3,8H,4-7H2 |
| InChIKey | BYTRAKIIPAXUAA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one?
The IUPAC name of 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one (CID 64506189) is 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one.
What is the SMILES notation for 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one?
The canonical SMILES for 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one is O=C(CCc1c(F)cccc1F)C1CC1.
What is the InChIKey of 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one?
The InChIKey is BYTRAKIIPAXUAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O/c13-10-2-1-3-11(14)9(10)6-7-12(15)8-4-5-8/h1-3,8H,4-7H2.
What are the key properties of 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one?
1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one has a molecular weight of 210.22 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one is sourced from PubChem (CID 64506189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).