C12H12F2O — CID 64506189
1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one (PubChem CID 64506189) has the molecular formula C12H12F2O and a molecular weight of 210.22 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one.
| Compound Name | 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 64506189 |
| Molecular Formula | C12H12F2O |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-cyclopropyl-3-(2,6-difluorophenyl)propan-1-one |
| SMILES | O=C(CCc1c(F)cccc1F)C1CC1 |
| InChI | InChI=1S/C12H12F2O/c13-10-2-1-3-11(14)9(10)6-7-12(15)8-4-5-8/h1-3,8H,4-7H2 |
| InChIKey | BYTRAKIIPAXUAA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |