C17H26N2O — CID 64508815
2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1-ethylpiperidin-3-amine (PubChem CID 64508815) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1-ethylpiperidin-3-amine.
| Compound Name | 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1-ethylpiperidin-3-amine |
|---|---|
| PubChem CID | 64508815 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1-ethylpiperidin-3-amine |
| SMILES | CCN1CCCC(N)C1c1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C17H26N2O/c1-4-19-10-6-9-14(18)15(19)13-8-5-7-12-11-17(2,3)20-16(12)13/h5,7-8,14-15H,4,6,9-11,18H2,1-3H3 |
| InChIKey | YTEGEPNAKDTPOS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |