C18H28N2O — CID 64507040
2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1-ethylazepan-3-amine (PubChem CID 64507040) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1-ethylazepan-3-amine.
| Compound Name | 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1-ethylazepan-3-amine |
|---|---|
| PubChem CID | 64507040 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1-ethylazepan-3-amine |
| SMILES | CCN1CCCCC(N)C1c1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C18H28N2O/c1-4-20-11-6-5-10-15(19)16(20)14-9-7-8-13-12-18(2,3)21-17(13)14/h7-9,15-16H,4-6,10-12,19H2,1-3H3 |
| InChIKey | LPTKCBPDAXAELJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |