C12H10F2N4O3 — CID 64511500
4,5-difluoro-N-(1H-imidazol-2-ylmethyl)-N-methyl-2-nitrobenzamide (PubChem CID 64511500) has the molecular formula C12H10F2N4O3 and a molecular weight of 296.23 g/mol. Its IUPAC name is 4,5-difluoro-N-(1H-imidazol-2-ylmethyl)-N-methyl-2-nitrobenzamide.
| Compound Name | 4,5-difluoro-N-(1H-imidazol-2-ylmethyl)-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 64511500 |
| Molecular Formula | C12H10F2N4O3 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4,5-difluoro-N-(1H-imidazol-2-ylmethyl)-N-methyl-2-nitrobenzamide |
| SMILES | CN(Cc1ncc[nH]1)C(=O)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10F2N4O3/c1-17(6-11-15-2-3-16-11)12(19)7-4-8(13)9(14)5-10(7)18(20)21/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | HOWIJXWGPOENTG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|