C12H18N2O — CID 64513237
3-(2-amino-3-pyridinyl)cycloheptan-1-ol (PubChem CID 64513237) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-(2-amino-3-pyridinyl)cycloheptan-1-ol.
| Compound Name | 3-(2-amino-3-pyridinyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 64513237 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-(2-amino-3-pyridinyl)cycloheptan-1-ol |
| SMILES | Nc1ncccc1C1CCCCC(O)C1 |
| InChI | InChI=1S/C12H18N2O/c13-12-11(6-3-7-14-12)9-4-1-2-5-10(15)8-9/h3,6-7,9-10,15H,1-2,4-5,8H2,(H2,13,14) |
| InChIKey | KMCLRVLDHQQYGT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |