C11H17ClN2 — CID 64515914
2-(3-chlorocyclohexyl)-1-ethylimidazole (PubChem CID 64515914) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 2-(3-chlorocyclohexyl)-1-ethylimidazole.
| Compound Name | 2-(3-chlorocyclohexyl)-1-ethylimidazole |
|---|---|
| PubChem CID | 64515914 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-(3-chlorocyclohexyl)-1-ethylimidazole |
| SMILES | CCn1ccnc1C1CCCC(Cl)C1 |
| InChI | InChI=1S/C11H17ClN2/c1-2-14-7-6-13-11(14)9-4-3-5-10(12)8-9/h6-7,9-10H,2-5,8H2,1H3 |
| InChIKey | MZSHTEYHHJWQJT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|