C18H25ClN2OS — CID 6451642
1-(2-methylphenyl)-4-(3-thiophen-2-yloxypropyl)piperazine;hydrochloride (PubChem CID 6451642) has the molecular formula C18H25ClN2OS and a molecular weight of 352.93 g/mol. Its IUPAC name is 1-(2-methylphenyl)-4-(3-thiophen-2-yloxypropyl)piperazine;hydrochloride.
| Compound Name | 1-(2-methylphenyl)-4-(3-thiophen-2-yloxypropyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 6451642 |
| Molecular Formula | C18H25ClN2OS |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-(2-methylphenyl)-4-(3-thiophen-2-yloxypropyl)piperazine;hydrochloride |
| SMILES | Cc1ccccc1N1CCN(CCCOc2cccs2)CC1.Cl |
| InChI | InChI=1S/C18H24N2OS.ClH/c1-16-6-2-3-7-17(16)20-12-10-19(11-13-20)9-5-14-21-18-8-4-15-22-18;/h2-4,6-8,15H,5,9-14H2,1H3;1H |
| InChIKey | LHSALRSAMSISAT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|