C17H25BrN2O — CID 64521005
5-bromo-N-cyclopropyl-N-(cyclopropylmethyl)-2-[(2-methoxyethylamino)methyl]aniline (PubChem CID 64521005) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is 5-bromo-N-cyclopropyl-N-(cyclopropylmethyl)-2-[(2-methoxyethylamino)methyl]aniline.
| Compound Name | 5-bromo-N-cyclopropyl-N-(cyclopropylmethyl)-2-[(2-methoxyethylamino)methyl]aniline |
|---|---|
| PubChem CID | 64521005 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 5-bromo-N-cyclopropyl-N-(cyclopropylmethyl)-2-[(2-methoxyethylamino)methyl]aniline |
| SMILES | COCCNCc1ccc(Br)cc1N(CC1CC1)C1CC1 |
| InChI | InChI=1S/C17H25BrN2O/c1-21-9-8-19-11-14-4-5-15(18)10-17(14)20(16-6-7-16)12-13-2-3-13/h4-5,10,13,16,19H,2-3,6-9,11-12H2,1H3 |
| InChIKey | ABVRIABVGUGNGE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|