C12H20N4O3 — CID 64524727
7-(1H-imidazol-2-ylmethylcarbamoylamino)heptanoic acid (PubChem CID 64524727) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 7-(1H-imidazol-2-ylmethylcarbamoylamino)heptanoic acid.
| Compound Name | 7-(1H-imidazol-2-ylmethylcarbamoylamino)heptanoic acid |
|---|---|
| PubChem CID | 64524727 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 7-(1H-imidazol-2-ylmethylcarbamoylamino)heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)NCc1ncc[nH]1 |
| InChI | InChI=1S/C12H20N4O3/c17-11(18)5-3-1-2-4-6-15-12(19)16-9-10-13-7-8-14-10/h7-8H,1-6,9H2,(H,13,14)(H,17,18)(H2,15,16,19) |
| InChIKey | WZNRQIRDUHGOJV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|