C11H14N4O2 — CID 64525222
3-amino-N-ethyl-N-(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide (PubChem CID 64525222) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 3-amino-N-ethyl-N-(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-ethyl-N-(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 64525222 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-amino-N-ethyl-N-(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCN(Cc1ccco1)C(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C11H14N4O2/c1-2-15(7-8-4-3-5-17-8)11(16)9-6-10(12)14-13-9/h3-6H,2,7H2,1H3,(H3,12,13,14) |
| InChIKey | YNQBCHIPOMEGLS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |