C15H19Cl2NO2 — CID 64526651
3-(2,5-dichlorophenyl)-3-piperidin-1-ylbutanoic acid (PubChem CID 64526651) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-3-piperidin-1-ylbutanoic acid.
| Compound Name | 3-(2,5-dichlorophenyl)-3-piperidin-1-ylbutanoic acid |
|---|---|
| PubChem CID | 64526651 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-3-piperidin-1-ylbutanoic acid |
| SMILES | CC(CC(=O)O)(c1cc(Cl)ccc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-15(10-14(19)20,18-7-3-2-4-8-18)12-9-11(16)5-6-13(12)17/h5-6,9H,2-4,7-8,10H2,1H3,(H,19,20) |
| InChIKey | FREPKYUWDNKYMV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |