C14H16Cl2FNO2 — CID 64528143
3-(2,4-dichloro-5-fluorophenyl)-3-pyrrolidin-1-ylbutanoic acid (PubChem CID 64528143) has the molecular formula C14H16Cl2FNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is 3-(2,4-dichloro-5-fluorophenyl)-3-pyrrolidin-1-ylbutanoic acid.
| Compound Name | 3-(2,4-dichloro-5-fluorophenyl)-3-pyrrolidin-1-ylbutanoic acid |
|---|---|
| PubChem CID | 64528143 |
| Molecular Formula | C14H16Cl2FNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3-(2,4-dichloro-5-fluorophenyl)-3-pyrrolidin-1-ylbutanoic acid |
| SMILES | CC(CC(=O)O)(c1cc(F)c(Cl)cc1Cl)N1CCCC1 |
| InChI | InChI=1S/C14H16Cl2FNO2/c1-14(8-13(19)20,18-4-2-3-5-18)9-6-12(17)11(16)7-10(9)15/h6-7H,2-5,8H2,1H3,(H,19,20) |
| InChIKey | JDDSGLZXWXSPES-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|