C15H20F2N2O2 — CID 65421428
3-(2,5-difluorophenyl)-3-(4-methylpiperazin-1-yl)butanoic acid (PubChem CID 65421428) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-3-(4-methylpiperazin-1-yl)butanoic acid.
| Compound Name | 3-(2,5-difluorophenyl)-3-(4-methylpiperazin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 65421428 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-(2,5-difluorophenyl)-3-(4-methylpiperazin-1-yl)butanoic acid |
| SMILES | CN1CCN(C(C)(CC(=O)O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-15(10-14(20)21,19-7-5-18(2)6-8-19)12-9-11(16)3-4-13(12)17/h3-4,9H,5-8,10H2,1-2H3,(H,20,21) |
| InChIKey | LCXSSUMIYHIWAY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |