C11H10N4O — CID 64528494
5-(6-methyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine (PubChem CID 64528494) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 5-(6-methyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(6-methyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 64528494 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 5-(6-methyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine |
| SMILES | Cc1ccc2nc(-c3cc(N)n[nH]3)oc2c1 |
| InChI | InChI=1S/C11H10N4O/c1-6-2-3-7-9(4-6)16-11(13-7)8-5-10(12)15-14-8/h2-5H,1H3,(H3,12,14,15) |
| InChIKey | FWOMIRPNHNOWTH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |