C10H17N5O2 — CID 64531342
N-[3-(1H-1,2,4-triazol-5-yl)propyl]morpholine-2-carboxamide (PubChem CID 64531342) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]morpholine-2-carboxamide.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 64531342 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]morpholine-2-carboxamide |
| SMILES | O=C(NCCCc1ncn[nH]1)C1CNCCO1 |
| InChI | InChI=1S/C10H17N5O2/c16-10(8-6-11-4-5-17-8)12-3-1-2-9-13-7-14-15-9/h7-8,11H,1-6H2,(H,12,16)(H,13,14,15) |
| InChIKey | UYEOXEMCUKHMKG-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|