C11H8Cl2N4O3 — CID 64532271
3,4-dichloro-N-(1H-imidazol-2-ylmethyl)-5-nitrobenzamide (PubChem CID 64532271) has the molecular formula C11H8Cl2N4O3 and a molecular weight of 315.12 g/mol. Its IUPAC name is 3,4-dichloro-N-(1H-imidazol-2-ylmethyl)-5-nitrobenzamide.
| Compound Name | 3,4-dichloro-N-(1H-imidazol-2-ylmethyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 64532271 |
| Molecular Formula | C11H8Cl2N4O3 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 3,4-dichloro-N-(1H-imidazol-2-ylmethyl)-5-nitrobenzamide |
| SMILES | O=C(NCc1ncc[nH]1)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H8Cl2N4O3/c12-7-3-6(4-8(10(7)13)17(19)20)11(18)16-5-9-14-1-2-15-9/h1-4H,5H2,(H,14,15)(H,16,18) |
| InChIKey | NZUAAWWBWXHIKS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|