C17H18N2O2 — CID 64533171
3-(3,4-dimethoxyanilino)-2-phenylpropanenitrile (PubChem CID 64533171) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(3,4-dimethoxyanilino)-2-phenylpropanenitrile.
| Compound Name | 3-(3,4-dimethoxyanilino)-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 64533171 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-(3,4-dimethoxyanilino)-2-phenylpropanenitrile |
| SMILES | COc1ccc(NCC(C#N)c2ccccc2)cc1OC |
| InChI | InChI=1S/C17H18N2O2/c1-20-16-9-8-15(10-17(16)21-2)19-12-14(11-18)13-6-4-3-5-7-13/h3-10,14,19H,12H2,1-2H3 |
| InChIKey | CMAYPDBZZVKNJB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|