About 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine
2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine (PubChem CID 64533467) has the molecular formula C7H11N3OS2
and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine.
Molecular Properties
| Compound Name | 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine |
| PubChem CID | 64533467 |
| Molecular Formula | C7H11N3OS2 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine |
| SMILES | c1nnc(SCC2CNCCO2)s1 |
| InChI | InChI=1S/C7H11N3OS2/c1-2-11-6(3-8-1)4-12-7-10-9-5-13-7/h5-6,8H,1-4H2 |
| InChIKey | SDSVSVQNAYUJIJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine?
The IUPAC name of 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine (CID 64533467) is 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine.
What is the SMILES notation for 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine?
The canonical SMILES for 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine is c1nnc(SCC2CNCCO2)s1.
What is the InChIKey of 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine?
The InChIKey is SDSVSVQNAYUJIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS2/c1-2-11-6(3-8-1)4-12-7-10-9-5-13-7/h5-6,8H,1-4H2.
What are the key properties of 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine?
2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine has a molecular weight of 217.32 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)morpholine is sourced from PubChem (CID 64533467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).