C11H13F3N2OS — CID 64534066
2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]morpholine (PubChem CID 64534066) has the molecular formula C11H13F3N2OS and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]morpholine.
| Compound Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]morpholine |
|---|---|
| PubChem CID | 64534066 |
| Molecular Formula | C11H13F3N2OS |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]morpholine |
| SMILES | FC(F)(F)c1ccc(SCC2CNCCO2)nc1 |
| InChI | InChI=1S/C11H13F3N2OS/c12-11(13,14)8-1-2-10(16-5-8)18-7-9-6-15-3-4-17-9/h1-2,5,9,15H,3-4,6-7H2 |
| InChIKey | SHPLRACRYJVHLT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |