C19H22F3N3O — CID 123186475
2-[5-[4-[5-(trifluoromethyl)-2-pyridinyl]butan-2-yl]-2-pyridinyl]morpholine (PubChem CID 123186475) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is 2-[5-[4-[5-(trifluoromethyl)-2-pyridinyl]butan-2-yl]-2-pyridinyl]morpholine.
| Compound Name | 2-[5-[4-[5-(trifluoromethyl)-2-pyridinyl]butan-2-yl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 123186475 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[5-[4-[5-(trifluoromethyl)-2-pyridinyl]butan-2-yl]-2-pyridinyl]morpholine |
| SMILES | CC(CCc1ccc(C(F)(F)F)cn1)c1ccc(C2CNCCO2)nc1 |
| InChI | InChI=1S/C19H22F3N3O/c1-13(2-5-16-6-4-15(11-24-16)19(20,21)22)14-3-7-17(25-10-14)18-12-23-8-9-26-18/h3-4,6-7,10-11,13,18,23H,2,5,8-9,12H2,1H3 |
| InChIKey | SOGFJMLQICNNKL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |