C13H13F3N2OS — CID 66434796
2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]morpholine (PubChem CID 66434796) has the molecular formula C13H13F3N2OS and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]morpholine.
| Compound Name | 2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 66434796 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]morpholine |
| SMILES | FC(F)(F)c1ccc2sc(CC3CNCCO3)nc2c1 |
| InChI | InChI=1S/C13H13F3N2OS/c14-13(15,16)8-1-2-11-10(5-8)18-12(20-11)6-9-7-17-3-4-19-9/h1-2,5,9,17H,3-4,6-7H2 |
| InChIKey | SKOAQFIOXQNKGY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |