C12H13F3N2S — CID 43152023
N-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propan-1-amine (PubChem CID 43152023) has the molecular formula C12H13F3N2S and a molecular weight of 274.31 g/mol. Its IUPAC name is N-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propan-1-amine.
| Compound Name | N-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 43152023 |
| Molecular Formula | C12H13F3N2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propan-1-amine |
| SMILES | CNCCCc1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C12H13F3N2S/c1-16-6-2-3-11-17-9-7-8(12(13,14)15)4-5-10(9)18-11/h4-5,7,16H,2-3,6H2,1H3 |
| InChIKey | HKBBKHFAGGGLRZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|