C10H6F3NO2S — CID 174767325
[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl formate (PubChem CID 174767325) has the molecular formula C10H6F3NO2S and a molecular weight of 261.22 g/mol. Its IUPAC name is [5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl formate.
| Compound Name | [5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl formate |
|---|---|
| PubChem CID | 174767325 |
| Molecular Formula | C10H6F3NO2S |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | [5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl formate |
| SMILES | O=COCc1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C10H6F3NO2S/c11-10(12,13)6-1-2-8-7(3-6)14-9(17-8)4-16-5-15/h1-3,5H,4H2 |
| InChIKey | QZQMYTHYCBBWGO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|