C15H11F3N2S2 — CID 86075020
4-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methylsulfanyl]aniline (PubChem CID 86075020) has the molecular formula C15H11F3N2S2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methylsulfanyl]aniline.
| Compound Name | 4-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methylsulfanyl]aniline |
|---|---|
| PubChem CID | 86075020 |
| Molecular Formula | C15H11F3N2S2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 4-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methylsulfanyl]aniline |
| SMILES | Nc1ccc(SCc2nc3cc(C(F)(F)F)ccc3s2)cc1 |
| InChI | InChI=1S/C15H11F3N2S2/c16-15(17,18)9-1-6-13-12(7-9)20-14(22-13)8-21-11-4-2-10(19)3-5-11/h1-7H,8,19H2 |
| InChIKey | VVWUTMLJPXABMB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|