C14H12N2S2 — CID 79206609
2-(phenylsulfanylmethyl)-1,3-benzothiazol-6-amine (PubChem CID 79206609) has the molecular formula C14H12N2S2 and a molecular weight of 272.40 g/mol. Its IUPAC name is 2-(phenylsulfanylmethyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(phenylsulfanylmethyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 79206609 |
| Molecular Formula | C14H12N2S2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-(phenylsulfanylmethyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(CSc3ccccc3)sc2c1 |
| InChI | InChI=1S/C14H12N2S2/c15-10-6-7-12-13(8-10)18-14(16-12)9-17-11-4-2-1-3-5-11/h1-8H,9,15H2 |
| InChIKey | YQXNRYZNMLRBNH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|