C14H11BrN2S — CID 66204024
2-[(3-bromophenyl)methyl]-1,3-benzothiazol-6-amine (PubChem CID 66204024) has the molecular formula C14H11BrN2S and a molecular weight of 319.23 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 66204024 |
| Molecular Formula | C14H11BrN2S |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(Cc3cccc(Br)c3)sc2c1 |
| InChI | InChI=1S/C14H11BrN2S/c15-10-3-1-2-9(6-10)7-14-17-12-5-4-11(16)8-13(12)18-14/h1-6,8H,7,16H2 |
| InChIKey | CSVHQZKZXDRFOX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|