About 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole
6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole (PubChem CID 158770073) has the molecular formula C11H7BrN2S2
and a molecular weight of 311.23 g/mol. Its IUPAC name is 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole |
| PubChem CID | 158770073 |
| Molecular Formula | C11H7BrN2S2 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole |
| SMILES | Brc1ccc2nc(Cc3nccs3)sc2c1 |
| InChI | InChI=1S/C11H7BrN2S2/c12-7-1-2-8-9(5-7)16-11(14-8)6-10-13-3-4-15-10/h1-5H,6H2 |
| InChIKey | PNPAOLMCJLHERO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole?
The IUPAC name of 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole (CID 158770073) is 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole.
What is the SMILES notation for 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole?
The canonical SMILES for 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole is Brc1ccc2nc(Cc3nccs3)sc2c1.
What is the InChIKey of 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole?
The InChIKey is PNPAOLMCJLHERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrN2S2/c12-7-1-2-8-9(5-7)16-11(14-8)6-10-13-3-4-15-10/h1-5H,6H2.
What are the key properties of 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole?
6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole has a molecular weight of 311.23 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole is sourced from PubChem (CID 158770073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).