C11H7BrN2S2 — CID 158770073
6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole (PubChem CID 158770073) has the molecular formula C11H7BrN2S2 and a molecular weight of 311.23 g/mol. Its IUPAC name is 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole.
| Compound Name | 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 158770073 |
| Molecular Formula | C11H7BrN2S2 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | 6-bromo-2-(1,3-thiazol-2-ylmethyl)-1,3-benzothiazole |
| SMILES | Brc1ccc2nc(Cc3nccs3)sc2c1 |
| InChI | InChI=1S/C11H7BrN2S2/c12-7-1-2-8-9(5-7)16-11(14-8)6-10-13-3-4-15-10/h1-5H,6H2 |
| InChIKey | PNPAOLMCJLHERO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |