C18H22F3N3O2S — CID 86897594
2,2-dimethyl-N-[2-[3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propanoylamino]ethyl]propanamide (PubChem CID 86897594) has the molecular formula C18H22F3N3O2S and a molecular weight of 401.45 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propanoylamino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propanoylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 86897594 |
| Molecular Formula | C18H22F3N3O2S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2,2-dimethyl-N-[2-[3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propanoylamino]ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCNC(=O)CCc1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C18H22F3N3O2S/c1-17(2,3)16(26)23-9-8-22-14(25)6-7-15-24-12-10-11(18(19,20)21)4-5-13(12)27-15/h4-5,10H,6-9H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | WFEYFTDDCLWGKK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|