About 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one
4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one (PubChem CID 64534254) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one |
| PubChem CID | 64534254 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(CC2CNCCO2)c1C |
| InChI | InChI=1S/C10H16N2O2S/c1-7-8(2)15-10(13)12(7)6-9-5-11-3-4-14-9/h9,11H,3-6H2,1-2H3 |
| InChIKey | BIVPHWOPFBGFHT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one?
The IUPAC name of 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one (CID 64534254) is 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one.
What is the SMILES notation for 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one?
The canonical SMILES for 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one is Cc1sc(=O)n(CC2CNCCO2)c1C.
What is the InChIKey of 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one?
The InChIKey is BIVPHWOPFBGFHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-7-8(2)15-10(13)12(7)6-9-5-11-3-4-14-9/h9,11H,3-6H2,1-2H3.
What are the key properties of 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one?
4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one has a molecular weight of 228.32 g/mol, XLogP of 0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-(morpholin-2-ylmethyl)-1,3-thiazol-2-one is sourced from PubChem (CID 64534254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).