C10H17N3O2 — CID 6453611
cyclohexanamine;1,2-dihydropyridazine-3,6-dione (PubChem CID 6453611) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is cyclohexanamine;1,2-dihydropyridazine-3,6-dione.
| Compound Name | cyclohexanamine;1,2-dihydropyridazine-3,6-dione |
|---|---|
| PubChem CID | 6453611 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | cyclohexanamine;1,2-dihydropyridazine-3,6-dione |
| SMILES | NC1CCCCC1.O=c1ccc(=O)[nH][nH]1 |
| InChI | InChI=1S/C6H13N.C4H4N2O2/c7-6-4-2-1-3-5-6;7-3-1-2-4(8)6-5-3/h6H,1-5,7H2;1-2H,(H,5,7)(H,6,8) |
| InChIKey | DNOPESRYPXXYIL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |