C10H14N2O2 — CID 71385091
2-cyclohexyl-1H-pyridazine-3,6-dione (PubChem CID 71385091) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-cyclohexyl-1H-pyridazine-3,6-dione.
| Compound Name | 2-cyclohexyl-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 71385091 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-cyclohexyl-1H-pyridazine-3,6-dione |
| SMILES | O=c1ccc(=O)n(C2CCCCC2)[nH]1 |
| InChI | InChI=1S/C10H14N2O2/c13-9-6-7-10(14)12(11-9)8-4-2-1-3-5-8/h6-8H,1-5H2,(H,11,13) |
| InChIKey | ZJVUUWUZRNHPCW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |