C12H22N4O2 — CID 64541943
3-[(2-amino-3-hydroxybutyl)amino]-1-tert-butylpyrazin-2-one (PubChem CID 64541943) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-[(2-amino-3-hydroxybutyl)amino]-1-tert-butylpyrazin-2-one.
| Compound Name | 3-[(2-amino-3-hydroxybutyl)amino]-1-tert-butylpyrazin-2-one |
|---|---|
| PubChem CID | 64541943 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 3-[(2-amino-3-hydroxybutyl)amino]-1-tert-butylpyrazin-2-one |
| SMILES | CC(O)C(N)CNc1nccn(C(C)(C)C)c1=O |
| InChI | InChI=1S/C12H22N4O2/c1-8(17)9(13)7-15-10-11(18)16(6-5-14-10)12(2,3)4/h5-6,8-9,17H,7,13H2,1-4H3,(H,14,15) |
| InChIKey | AAPHYEWZLMBHQW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |