C10H18N2S — CID 64544094
N-[1-(2-ethyl-1,3-thiazol-4-yl)ethyl]propan-1-amine (PubChem CID 64544094) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is N-[1-(2-ethyl-1,3-thiazol-4-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2-ethyl-1,3-thiazol-4-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 64544094 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-[1-(2-ethyl-1,3-thiazol-4-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1csc(CC)n1 |
| InChI | InChI=1S/C10H18N2S/c1-4-6-11-8(3)9-7-13-10(5-2)12-9/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | RNTCMSFQZNVZHN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |