C7H10INS — CID 137495501
2-ethyl-4-(1-iodoethyl)-1,3-thiazole (PubChem CID 137495501) has the molecular formula C7H10INS and a molecular weight of 267.13 g/mol. Its IUPAC name is 2-ethyl-4-(1-iodoethyl)-1,3-thiazole.
| Compound Name | 2-ethyl-4-(1-iodoethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 137495501 |
| Molecular Formula | C7H10INS |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.96 |
| IUPAC Name | 2-ethyl-4-(1-iodoethyl)-1,3-thiazole |
| SMILES | CCc1nc(C(C)I)cs1 |
| InChI | InChI=1S/C7H10INS/c1-3-7-9-6(4-10-7)5(2)8/h4-5H,3H2,1-2H3 |
| InChIKey | HPZTZTLWWFQOGH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|