C13H14N2O2S — CID 64544622
1-[2-(3-methoxy-N-methylanilino)-1,3-thiazol-4-yl]ethanone (PubChem CID 64544622) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-[2-(3-methoxy-N-methylanilino)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(3-methoxy-N-methylanilino)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 64544622 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-[2-(3-methoxy-N-methylanilino)-1,3-thiazol-4-yl]ethanone |
| SMILES | COc1cccc(N(C)c2nc(C(C)=O)cs2)c1 |
| InChI | InChI=1S/C13H14N2O2S/c1-9(16)12-8-18-13(14-12)15(2)10-5-4-6-11(7-10)17-3/h4-8H,1-3H3 |
| InChIKey | GEEZUIJXDFMYBQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |