C12H10ClNO2S — CID 116890216
1-[2-(2-chloro-4-methoxyphenyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 116890216) has the molecular formula C12H10ClNO2S and a molecular weight of 267.74 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-methoxyphenyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(2-chloro-4-methoxyphenyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 116890216 |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 1-[2-(2-chloro-4-methoxyphenyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | COc1ccc(-c2nc(C(C)=O)cs2)c(Cl)c1 |
| InChI | InChI=1S/C12H10ClNO2S/c1-7(15)11-6-17-12(14-11)9-4-3-8(16-2)5-10(9)13/h3-6H,1-2H3 |
| InChIKey | ZSCHFQKTJPUEQQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |