C15H17ClN2O3S — CID 42866186
2-(2-chloro-4-ethoxyphenyl)-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide (PubChem CID 42866186) has the molecular formula C15H17ClN2O3S and a molecular weight of 340.83 g/mol. Its IUPAC name is 2-(2-chloro-4-ethoxyphenyl)-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-chloro-4-ethoxyphenyl)-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42866186 |
| Molecular Formula | C15H17ClN2O3S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-(2-chloro-4-ethoxyphenyl)-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(=O)NCCOC)cs2)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClN2O3S/c1-3-21-10-4-5-11(12(16)8-10)15-18-13(9-22-15)14(19)17-6-7-20-2/h4-5,8-9H,3,6-7H2,1-2H3,(H,17,19) |
| InChIKey | QGOXDAHSNCXPCH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|