C10H16N6 — CID 64546572
N-[(1-ethylimidazol-2-yl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 64546572) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N-[(1-ethylimidazol-2-yl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 64546572 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | CCn1ccnc1CNCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H16N6/c1-2-16-6-5-12-10(16)7-11-4-3-9-13-8-14-15-9/h5-6,8,11H,2-4,7H2,1H3,(H,13,14,15) |
| InChIKey | LCQVUSYBLYPVSF-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|