C16H28N4O — CID 64547266
4-butyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]cyclohexane-1-carboxamide (PubChem CID 64547266) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-butyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 64547266 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 4-butyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)NCCCc2ncn[nH]2)CC1 |
| InChI | InChI=1S/C16H28N4O/c1-2-3-5-13-7-9-14(10-8-13)16(21)17-11-4-6-15-18-12-19-20-15/h12-14H,2-11H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | GCCDZUPNQASBLB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|