C12H14N4O4S — CID 64548188
2-methyl-3-[2-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]benzoic acid (PubChem CID 64548188) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-methyl-3-[2-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]benzoic acid.
| Compound Name | 2-methyl-3-[2-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 64548188 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-methyl-3-[2-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]benzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1S(=O)(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H14N4O4S/c1-8-9(12(17)18)3-2-4-10(8)21(19,20)15-6-5-11-13-7-14-16-11/h2-4,7,15H,5-6H2,1H3,(H,17,18)(H,13,14,16) |
| InChIKey | GUWOBVAXPYJEEQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |