C9H11N5 — CID 64548272
4-N-(1H-imidazol-2-ylmethyl)pyridine-3,4-diamine (PubChem CID 64548272) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-N-(1H-imidazol-2-ylmethyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(1H-imidazol-2-ylmethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 64548272 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 4-N-(1H-imidazol-2-ylmethyl)pyridine-3,4-diamine |
| SMILES | Nc1cnccc1NCc1ncc[nH]1 |
| InChI | InChI=1S/C9H11N5/c10-7-5-11-2-1-8(7)14-6-9-12-3-4-13-9/h1-5H,6,10H2,(H,11,14)(H,12,13) |
| InChIKey | LZGVIRCYDOSBHA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |