C14H20F3NO2 — CID 64548724
2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]-2-methylbutan-1-ol (PubChem CID 64548724) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]-2-methylbutan-1-ol.
| Compound Name | 2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 64548724 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]-2-methylbutan-1-ol |
| SMILES | CCC(C)(CO)NCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NO2/c1-3-13(2,9-19)18-8-12(20)10-5-4-6-11(7-10)14(15,16)17/h4-7,12,18-20H,3,8-9H2,1-2H3 |
| InChIKey | QLXLPLGSLSWPPJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |