C15H26N2O3 — CID 64551881
methyl 1-(1-amino-3-methylcyclohexanecarbonyl)piperidine-2-carboxylate (PubChem CID 64551881) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl 1-(1-amino-3-methylcyclohexanecarbonyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(1-amino-3-methylcyclohexanecarbonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 64551881 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | methyl 1-(1-amino-3-methylcyclohexanecarbonyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)C1(N)CCCC(C)C1 |
| InChI | InChI=1S/C15H26N2O3/c1-11-6-5-8-15(16,10-11)14(19)17-9-4-3-7-12(17)13(18)20-2/h11-12H,3-10,16H2,1-2H3 |
| InChIKey | GRKHHBPJFFGMAF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |